C14H22ClN3O2 — CID 111926716
1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[3-(hydroxymethyl)pentan-3-yl]urea (PubChem CID 111926716) has the molecular formula C14H22ClN3O2 and a molecular weight of 299.80 g/mol. Its IUPAC name is 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[3-(hydroxymethyl)pentan-3-yl]urea.
| Compound Name | 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[3-(hydroxymethyl)pentan-3-yl]urea |
|---|---|
| PubChem CID | 111926716 |
| Molecular Formula | C14H22ClN3O2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[3-(hydroxymethyl)pentan-3-yl]urea |
| SMILES | CCC(CC)(CO)NC(=O)Nc1c(C)cc(C)nc1Cl |
| InChI | InChI=1S/C14H22ClN3O2/c1-5-14(6-2,8-19)18-13(20)17-11-9(3)7-10(4)16-12(11)15/h7,19H,5-6,8H2,1-4H3,(H2,17,18,20) |
| InChIKey | MMFGUWYYHYWCEE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|