C13H20ClN3O2 — CID 111926719
1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-(4-hydroxy-2-methylbutan-2-yl)urea (PubChem CID 111926719) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.77 g/mol. Its IUPAC name is 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-(4-hydroxy-2-methylbutan-2-yl)urea.
| Compound Name | 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-(4-hydroxy-2-methylbutan-2-yl)urea |
|---|---|
| PubChem CID | 111926719 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-(4-hydroxy-2-methylbutan-2-yl)urea |
| SMILES | Cc1cc(C)c(NC(=O)NC(C)(C)CCO)c(Cl)n1 |
| InChI | InChI=1S/C13H20ClN3O2/c1-8-7-9(2)15-11(14)10(8)16-12(19)17-13(3,4)5-6-18/h7,18H,5-6H2,1-4H3,(H2,16,17,19) |
| InChIKey | IBDYBPSWFBHXGT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|