C13H18ClN3O2 — CID 111618253
1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[[1-(hydroxymethyl)cyclopropyl]methyl]urea (PubChem CID 111618253) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[[1-(hydroxymethyl)cyclopropyl]methyl]urea.
| Compound Name | 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[[1-(hydroxymethyl)cyclopropyl]methyl]urea |
|---|---|
| PubChem CID | 111618253 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[[1-(hydroxymethyl)cyclopropyl]methyl]urea |
| SMILES | Cc1cc(C)c(NC(=O)NCC2(CO)CC2)c(Cl)n1 |
| InChI | InChI=1S/C13H18ClN3O2/c1-8-5-9(2)16-11(14)10(8)17-12(19)15-6-13(7-18)3-4-13/h5,18H,3-4,6-7H2,1-2H3,(H2,15,17,19) |
| InChIKey | IBUIGXBSRVDNOM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|