About 1-butyl-3-cyanourea
1-butyl-3-cyanourea (PubChem CID 115571493) has the molecular formula C6H11N3O
and a molecular weight of 141.17 g/mol. Its IUPAC name is 1-butyl-3-cyanourea.
Molecular Properties
| Compound Name | 1-butyl-3-cyanourea |
| PubChem CID | 115571493 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 1-butyl-3-cyanourea |
| SMILES | CCCCNC(=O)NC#N |
| InChI | InChI=1S/C6H11N3O/c1-2-3-4-8-6(10)9-5-7/h2-4H2,1H3,(H2,8,9,10) |
| InChIKey | BFDMKSJIUBCDJV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-cyanourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-cyanourea?
The IUPAC name of 1-butyl-3-cyanourea (CID 115571493) is 1-butyl-3-cyanourea.
What is the SMILES notation for 1-butyl-3-cyanourea?
The canonical SMILES for 1-butyl-3-cyanourea is CCCCNC(=O)NC#N.
What is the InChIKey of 1-butyl-3-cyanourea?
The InChIKey is BFDMKSJIUBCDJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O/c1-2-3-4-8-6(10)9-5-7/h2-4H2,1H3,(H2,8,9,10).
What are the key properties of 1-butyl-3-cyanourea?
1-butyl-3-cyanourea has a molecular weight of 141.17 g/mol, XLogP of 0.57, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-cyanourea is sourced from PubChem (CID 115571493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).