About sodium;1-cyano-3-(2-sulfanylethyl)urea;hydride
sodium;1-cyano-3-(2-sulfanylethyl)urea;hydride (PubChem CID 173433404) has the molecular formula C4H8N3NaOS
and a molecular weight of 169.18 g/mol. Its IUPAC name is sodium;1-cyano-3-(2-sulfanylethyl)urea;hydride.
Molecular Properties
| Compound Name | sodium;1-cyano-3-(2-sulfanylethyl)urea;hydride |
| PubChem CID | 173433404 |
| Molecular Formula | C4H8N3NaOS |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | sodium;1-cyano-3-(2-sulfanylethyl)urea;hydride |
| SMILES | N#CNC(=O)NCCS.[H-].[Na+] |
| InChI | InChI=1S/C4H7N3OS.Na.H/c5-3-7-4(8)6-1-2-9;;/h9H,1-2H2,(H2,6,7,8);;/q;+1;-1 |
| InChIKey | MSKSBZDTKOSXEZ-UHFFFAOYSA-N |
| XLogP | -3.19 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;1-cyano-3-(2-sulfanylethyl)urea;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-cyano-3-(2-sulfanylethyl)urea;hydride?
The IUPAC name of sodium;1-cyano-3-(2-sulfanylethyl)urea;hydride (CID 173433404) is sodium;1-cyano-3-(2-sulfanylethyl)urea;hydride.
What is the SMILES notation for sodium;1-cyano-3-(2-sulfanylethyl)urea;hydride?
The canonical SMILES for sodium;1-cyano-3-(2-sulfanylethyl)urea;hydride is N#CNC(=O)NCCS.[H-].[Na+].
What is the InChIKey of sodium;1-cyano-3-(2-sulfanylethyl)urea;hydride?
The InChIKey is MSKSBZDTKOSXEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3OS.Na.H/c5-3-7-4(8)6-1-2-9;;/h9H,1-2H2,(H2,6,7,8);;/q;+1;-1.
What are the key properties of sodium;1-cyano-3-(2-sulfanylethyl)urea;hydride?
sodium;1-cyano-3-(2-sulfanylethyl)urea;hydride has a molecular weight of 169.18 g/mol, XLogP of -3.19, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-cyano-3-(2-sulfanylethyl)urea;hydride is sourced from PubChem (CID 173433404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).