About 1-cyano-3-pentylthiourea
1-cyano-3-pentylthiourea (PubChem CID 87957589) has the molecular formula C7H13N3S
and a molecular weight of 171.27 g/mol. Its IUPAC name is 1-cyano-3-pentylthiourea.
Molecular Properties
| Compound Name | 1-cyano-3-pentylthiourea |
| PubChem CID | 87957589 |
| Molecular Formula | C7H13N3S |
| Molecular Weight | 171.27 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 1-cyano-3-pentylthiourea |
| SMILES | CCCCCNC(=S)NC#N |
| InChI | InChI=1S/C7H13N3S/c1-2-3-4-5-9-7(11)10-6-8/h2-5H2,1H3,(H2,9,10,11) |
| InChIKey | ZZSGUMVFMXTNGL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyano-3-pentylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-3-pentylthiourea?
The IUPAC name of 1-cyano-3-pentylthiourea (CID 87957589) is 1-cyano-3-pentylthiourea.
What is the SMILES notation for 1-cyano-3-pentylthiourea?
The canonical SMILES for 1-cyano-3-pentylthiourea is CCCCCNC(=S)NC#N.
What is the InChIKey of 1-cyano-3-pentylthiourea?
The InChIKey is ZZSGUMVFMXTNGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3S/c1-2-3-4-5-9-7(11)10-6-8/h2-5H2,1H3,(H2,9,10,11).
What are the key properties of 1-cyano-3-pentylthiourea?
1-cyano-3-pentylthiourea has a molecular weight of 171.27 g/mol, XLogP of 1.12, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-3-pentylthiourea is sourced from PubChem (CID 87957589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).