C9H13N5O — CID 79503092
1-butyl-3-(4-cyano-1H-pyrazol-5-yl)urea (PubChem CID 79503092) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is 1-butyl-3-(4-cyano-1H-pyrazol-5-yl)urea.
| Compound Name | 1-butyl-3-(4-cyano-1H-pyrazol-5-yl)urea |
|---|---|
| PubChem CID | 79503092 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 1-butyl-3-(4-cyano-1H-pyrazol-5-yl)urea |
| SMILES | CCCCNC(=O)Nc1[nH]ncc1C#N |
| InChI | InChI=1S/C9H13N5O/c1-2-3-4-11-9(15)13-8-7(5-10)6-12-14-8/h6H,2-4H2,1H3,(H3,11,12,13,14,15) |
| InChIKey | YPZFFAHZDKLIMD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|