C9H13N5O — CID 79503578
3-(4-cyano-1H-pyrazol-5-yl)-1,1-diethylurea (PubChem CID 79503578) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is 3-(4-cyano-1H-pyrazol-5-yl)-1,1-diethylurea.
| Compound Name | 3-(4-cyano-1H-pyrazol-5-yl)-1,1-diethylurea |
|---|---|
| PubChem CID | 79503578 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 3-(4-cyano-1H-pyrazol-5-yl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1[nH]ncc1C#N |
| InChI | InChI=1S/C9H13N5O/c1-3-14(4-2)9(15)12-8-7(5-10)6-11-13-8/h6H,3-4H2,1-2H3,(H2,11,12,13,15) |
| InChIKey | LATAYHCDBICYPV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 84.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |