C17H17N5O3 — CID 169436964
3-[3-[acetyl(ethyl)amino]phenyl]-N-(4-cyano-1H-pyrazol-5-yl)-3-oxopropanamide (PubChem CID 169436964) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is 3-[3-[acetyl(ethyl)amino]phenyl]-N-(4-cyano-1H-pyrazol-5-yl)-3-oxopropanamide.
| Compound Name | 3-[3-[acetyl(ethyl)amino]phenyl]-N-(4-cyano-1H-pyrazol-5-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 169436964 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 3-[3-[acetyl(ethyl)amino]phenyl]-N-(4-cyano-1H-pyrazol-5-yl)-3-oxopropanamide |
| SMILES | CCN(C(C)=O)c1cccc(C(=O)CC(=O)Nc2[nH]ncc2C#N)c1 |
| InChI | InChI=1S/C17H17N5O3/c1-3-22(11(2)23)14-6-4-5-12(7-14)15(24)8-16(25)20-17-13(9-18)10-19-21-17/h4-7,10H,3,8H2,1-2H3,(H2,19,20,21,25) |
| InChIKey | UZNRQIQXYZHYHJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|