C17H17N5O2 — CID 70337335
N-[3-[3-[(4-cyano-1H-pyrazol-5-yl)imino]propanoyl]phenyl]-N-ethylacetamide (PubChem CID 70337335) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is N-[3-[3-[(4-cyano-1H-pyrazol-5-yl)imino]propanoyl]phenyl]-N-ethylacetamide.
| Compound Name | N-[3-[3-[(4-cyano-1H-pyrazol-5-yl)imino]propanoyl]phenyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 70337335 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[3-[3-[(4-cyano-1H-pyrazol-5-yl)imino]propanoyl]phenyl]-N-ethylacetamide |
| SMILES | CCN(C(C)=O)c1cccc(C(=O)CC=Nc2[nH]ncc2C#N)c1 |
| InChI | InChI=1S/C17H17N5O2/c1-3-22(12(2)23)15-6-4-5-13(9-15)16(24)7-8-19-17-14(10-18)11-20-21-17/h4-6,8-9,11H,3,7H2,1-2H3,(H,20,21) |
| InChIKey | MOXCHEMSQYLERP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|