C13H14N4O5 — CID 135604484
diethyl (Z)-2-[(E)-(4-cyano-1H-pyrazol-5-yl)iminomethyl]-3-hydroxybut-2-enedioate (PubChem CID 135604484) has the molecular formula C13H14N4O5 and a molecular weight of 306.28 g/mol. Its IUPAC name is diethyl (Z)-2-[(E)-(4-cyano-1H-pyrazol-5-yl)iminomethyl]-3-hydroxybut-2-enedioate.
| Compound Name | diethyl (Z)-2-[(E)-(4-cyano-1H-pyrazol-5-yl)iminomethyl]-3-hydroxybut-2-enedioate |
|---|---|
| PubChem CID | 135604484 |
| Molecular Formula | C13H14N4O5 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | diethyl (Z)-2-[(E)-(4-cyano-1H-pyrazol-5-yl)iminomethyl]-3-hydroxybut-2-enedioate |
| SMILES | CCOC(=O)/C(O)=C(\C=N\c1[nH]ncc1C#N)C(=O)OCC |
| InChI | InChI=1S/C13H14N4O5/c1-3-21-12(19)9(10(18)13(20)22-4-2)7-15-11-8(5-14)6-16-17-11/h6-7,18H,3-4H2,1-2H3,(H,16,17)/b10-9-,15-7+ |
| InChIKey | XSDXKXBNNHWJAA-IOEGRWEBSA-N |
| XLogP | 0.92 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|