C8H13N5OS — CID 79500493
1-(4-carbamothioyl-1H-pyrazol-5-yl)-3-propylurea (PubChem CID 79500493) has the molecular formula C8H13N5OS and a molecular weight of 227.29 g/mol. Its IUPAC name is 1-(4-carbamothioyl-1H-pyrazol-5-yl)-3-propylurea.
| Compound Name | 1-(4-carbamothioyl-1H-pyrazol-5-yl)-3-propylurea |
|---|---|
| PubChem CID | 79500493 |
| Molecular Formula | C8H13N5OS |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 1-(4-carbamothioyl-1H-pyrazol-5-yl)-3-propylurea |
| SMILES | CCCNC(=O)Nc1[nH]ncc1C(N)=S |
| InChI | InChI=1S/C8H13N5OS/c1-2-3-10-8(14)12-7-5(6(9)15)4-11-13-7/h4H,2-3H2,1H3,(H2,9,15)(H3,10,11,12,13,14) |
| InChIKey | HJEDBIZHTPIFPI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|