C12H11BrN4OS — CID 104851593
3-bromo-N-(4-carbamothioyl-1H-pyrazol-5-yl)-5-methylbenzamide (PubChem CID 104851593) has the molecular formula C12H11BrN4OS and a molecular weight of 339.22 g/mol. Its IUPAC name is 3-bromo-N-(4-carbamothioyl-1H-pyrazol-5-yl)-5-methylbenzamide.
| Compound Name | 3-bromo-N-(4-carbamothioyl-1H-pyrazol-5-yl)-5-methylbenzamide |
|---|---|
| PubChem CID | 104851593 |
| Molecular Formula | C12H11BrN4OS |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 3-bromo-N-(4-carbamothioyl-1H-pyrazol-5-yl)-5-methylbenzamide |
| SMILES | Cc1cc(Br)cc(C(=O)Nc2[nH]ncc2C(N)=S)c1 |
| InChI | InChI=1S/C12H11BrN4OS/c1-6-2-7(4-8(13)3-6)12(18)16-11-9(10(14)19)5-15-17-11/h2-5H,1H3,(H2,14,19)(H2,15,16,17,18) |
| InChIKey | HEPUXLVXCGMWIK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|