C11H10N4O2S — CID 79503125
N-(4-carbamothioyl-1H-pyrazol-5-yl)-3-hydroxybenzamide (PubChem CID 79503125) has the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. Its IUPAC name is N-(4-carbamothioyl-1H-pyrazol-5-yl)-3-hydroxybenzamide.
| Compound Name | N-(4-carbamothioyl-1H-pyrazol-5-yl)-3-hydroxybenzamide |
|---|---|
| PubChem CID | 79503125 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | N-(4-carbamothioyl-1H-pyrazol-5-yl)-3-hydroxybenzamide |
| SMILES | NC(=S)c1cn[nH]c1NC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C11H10N4O2S/c12-9(18)8-5-13-15-10(8)14-11(17)6-2-1-3-7(16)4-6/h1-5,16H,(H2,12,18)(H2,13,14,15,17) |
| InChIKey | QOGDLQWOMIPPEM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|