C11H9FN4OS — CID 79504447
N-(4-carbamothioyl-1H-pyrazol-5-yl)-3-fluorobenzamide (PubChem CID 79504447) has the molecular formula C11H9FN4OS and a molecular weight of 264.29 g/mol. Its IUPAC name is N-(4-carbamothioyl-1H-pyrazol-5-yl)-3-fluorobenzamide.
| Compound Name | N-(4-carbamothioyl-1H-pyrazol-5-yl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 79504447 |
| Molecular Formula | C11H9FN4OS |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | N-(4-carbamothioyl-1H-pyrazol-5-yl)-3-fluorobenzamide |
| SMILES | NC(=S)c1cn[nH]c1NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C11H9FN4OS/c12-7-3-1-2-6(4-7)11(17)15-10-8(9(13)18)5-14-16-10/h1-5H,(H2,13,18)(H2,14,15,16,17) |
| InChIKey | VWQYNZZQUVZTEV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|