C16H15ClN4O — CID 16763441
N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N',3-dimethylbenzohydrazide (PubChem CID 16763441) has the molecular formula C16H15ClN4O and a molecular weight of 314.78 g/mol. Its IUPAC name is N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N',3-dimethylbenzohydrazide.
| Compound Name | N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N',3-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 16763441 |
| Molecular Formula | C16H15ClN4O |
| Molecular Weight | 314.78 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N',3-dimethylbenzohydrazide |
| SMILES | Cc1cccc(C(=O)NN(C)c2cc(C)c(C#N)c(Cl)n2)c1 |
| InChI | InChI=1S/C16H15ClN4O/c1-10-5-4-6-12(7-10)16(22)20-21(3)14-8-11(2)13(9-18)15(17)19-14/h4-8H,1-3H3,(H,20,22) |
| InChIKey | VKGRSELYMUYSOG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.78 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|