C7H10N6 — CID 53405262
2,6-dihydrazinyl-4-methylpyridine-3-carbonitrile (PubChem CID 53405262) has the molecular formula C7H10N6 and a molecular weight of 178.20 g/mol. Its IUPAC name is 2,6-dihydrazinyl-4-methylpyridine-3-carbonitrile.
| Compound Name | 2,6-dihydrazinyl-4-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 53405262 |
| Molecular Formula | C7H10N6 |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2,6-dihydrazinyl-4-methylpyridine-3-carbonitrile |
| SMILES | Cc1cc(NN)nc(NN)c1C#N |
| InChI | InChI=1S/C7H10N6/c1-4-2-6(12-9)11-7(13-10)5(4)3-8/h2H,9-10H2,1H3,(H2,11,12,13) |
| InChIKey | DAVHDCDNAUEBSG-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|