C13H13F2N2OP — CID 166811323
[2-[3-[(1S)-2,2-dimethylcyclopropyl]-1,2,4-oxadiazol-5-yl]-3,6-difluorophenyl]phosphane (PubChem CID 166811323) has the molecular formula C13H13F2N2OP and a molecular weight of 282.23 g/mol. Its IUPAC name is [2-[3-[(1S)-2,2-dimethylcyclopropyl]-1,2,4-oxadiazol-5-yl]-3,6-difluorophenyl]phosphane.
| Compound Name | [2-[3-[(1S)-2,2-dimethylcyclopropyl]-1,2,4-oxadiazol-5-yl]-3,6-difluorophenyl]phosphane |
|---|---|
| PubChem CID | 166811323 |
| Molecular Formula | C13H13F2N2OP |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | [2-[3-[(1S)-2,2-dimethylcyclopropyl]-1,2,4-oxadiazol-5-yl]-3,6-difluorophenyl]phosphane |
| SMILES | CC1(C)C[C@@H]1c1noc(-c2c(F)ccc(F)c2P)n1 |
| InChI | InChI=1S/C13H13F2N2OP/c1-13(2)5-6(13)11-16-12(18-17-11)9-7(14)3-4-8(15)10(9)19/h3-4,6H,5,19H2,1-2H3/t6-/m1/s1 |
| InChIKey | IXCCBNKKJLWLDG-ZCFIWIBFSA-N |
| XLogP | 3.03 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|