C18H18FN5O2S — CID 166813587
4-[4-[1-(3-fluoro-2-pyridinyl)pyrazol-4-yl]phenyl]piperazine-1-sulfinic acid (PubChem CID 166813587) has the molecular formula C18H18FN5O2S and a molecular weight of 387.44 g/mol. Its IUPAC name is 4-[4-[1-(3-fluoro-2-pyridinyl)pyrazol-4-yl]phenyl]piperazine-1-sulfinic acid.
| Compound Name | 4-[4-[1-(3-fluoro-2-pyridinyl)pyrazol-4-yl]phenyl]piperazine-1-sulfinic acid |
|---|---|
| PubChem CID | 166813587 |
| Molecular Formula | C18H18FN5O2S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 4-[4-[1-(3-fluoro-2-pyridinyl)pyrazol-4-yl]phenyl]piperazine-1-sulfinic acid |
| SMILES | O=S(O)N1CCN(c2ccc(-c3cnn(-c4ncccc4F)c3)cc2)CC1 |
| InChI | InChI=1S/C18H18FN5O2S/c19-17-2-1-7-20-18(17)24-13-15(12-21-24)14-3-5-16(6-4-14)22-8-10-23(11-9-22)27(25)26/h1-7,12-13H,8-11H2,(H,25,26) |
| InChIKey | HHALHKNWSFILLY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|