C28H28ClF2N3O2S — CID 166815770
6-[2-(3-chlorophenyl)acetyl]-2-[1-[4-(4,4-difluorocyclohexyl)thiophen-2-yl]cyclopropyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 166815770) has the molecular formula C28H28ClF2N3O2S and a molecular weight of 544.07 g/mol. Its IUPAC name is 6-[2-(3-chlorophenyl)acetyl]-2-[1-[4-(4,4-difluorocyclohexyl)thiophen-2-yl]cyclopropyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[2-(3-chlorophenyl)acetyl]-2-[1-[4-(4,4-difluorocyclohexyl)thiophen-2-yl]cyclopropyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 166815770 |
| Molecular Formula | C28H28ClF2N3O2S |
| Molecular Weight | 544.07 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 6-[2-(3-chlorophenyl)acetyl]-2-[1-[4-(4,4-difluorocyclohexyl)thiophen-2-yl]cyclopropyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=C(Cc1cccc(Cl)c1)N1CCc2nc(C3(c4cc(C5CCC(F)(F)CC5)cs4)CC3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C28H28ClF2N3O2S/c29-20-3-1-2-17(12-20)13-24(35)34-11-6-22-21(15-34)25(36)33-26(32-22)27(9-10-27)23-14-19(16-37-23)18-4-7-28(30,31)8-5-18/h1-3,12,14,16,18H,4-11,13,15H2,(H,32,33,36) |
| InChIKey | ONPAUGIQDLKASD-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.07 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |