C25H32N6O4S3 — CID 166820878
(2S,3S)-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2-[[(2S)-2-[(4-isothiocyanatophenyl)carbamothioylamino]-4-methylsulfanylbutanoyl]amino]-3-methylpentanamide (PubChem CID 166820878) has the molecular formula C25H32N6O4S3 and a molecular weight of 576.77 g/mol. Its IUPAC name is (2S,3S)-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2-[[(2S)-2-[(4-isothiocyanatophenyl)carbamothioylamino]-4-methylsulfanylbutanoyl]amino]-3-methylpentanamide.
| Compound Name | (2S,3S)-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2-[[(2S)-2-[(4-isothiocyanatophenyl)carbamothioylamino]-4-methylsulfanylbutanoyl]amino]-3-methylpentanamide |
|---|---|
| PubChem CID | 166820878 |
| Molecular Formula | C25H32N6O4S3 |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | (2S,3S)-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2-[[(2S)-2-[(4-isothiocyanatophenyl)carbamothioylamino]-4-methylsulfanylbutanoyl]amino]-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCSC)NC(=S)Nc1ccc(N=C=S)cc1)C(=O)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C25H32N6O4S3/c1-4-16(2)22(24(35)26-12-13-31-20(32)9-10-21(31)33)30-23(34)19(11-14-38-3)29-25(37)28-18-7-5-17(6-8-18)27-15-36/h5-10,16,19,22H,4,11-14H2,1-3H3,(H,26,35)(H,30,34)(H2,28,29,37)/t16-,19-,22-/m0/s1 |
| InChIKey | XRIVUWFLOSAKLJ-BPXKWBHBSA-N |
| XLogP | 2.40 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|