C27H37F3N6O7S — CID 175704904
(2S,3S)-2-[[(2S)-2-[[4-(aminomethyl)phenyl]carbamoylamino]-4-methylsulfanylbutanoyl]amino]-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-methylpentanamide;2,2,2-trifluoroacetic acid (PubChem CID 175704904) has the molecular formula C27H37F3N6O7S and a molecular weight of 646.69 g/mol. Its IUPAC name is (2S,3S)-2-[[(2S)-2-[[4-(aminomethyl)phenyl]carbamoylamino]-4-methylsulfanylbutanoyl]amino]-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-methylpentanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,3S)-2-[[(2S)-2-[[4-(aminomethyl)phenyl]carbamoylamino]-4-methylsulfanylbutanoyl]amino]-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-methylpentanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175704904 |
| Molecular Formula | C27H37F3N6O7S |
| Molecular Weight | 646.69 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | (2S,3S)-2-[[(2S)-2-[[4-(aminomethyl)phenyl]carbamoylamino]-4-methylsulfanylbutanoyl]amino]-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-methylpentanamide;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCSC)NC(=O)Nc1ccc(CN)cc1)C(=O)NCCN1C(=O)C=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H36N6O5S.C2HF3O2/c1-4-16(2)22(24(35)27-12-13-31-20(32)9-10-21(31)33)30-23(34)19(11-14-37-3)29-25(36)28-18-7-5-17(15-26)6-8-18;3-2(4,5)1(6)7/h5-10,16,19,22H,4,11-15,26H2,1-3H3,(H,27,35)(H,30,34)(H2,28,29,36);(H,6,7)/t16-,19-,22-;/m0./s1 |
| InChIKey | BHBWWBRRDNAOTQ-KKWWWIARSA-N |
| XLogP | 1.59 |
| TPSA | 200.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.69 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|