C15H22N4O2S — CID 154988275
(2S)-2-[[4-(aminomethyl)phenyl]carbamoylamino]-4-ethylsulfanyl-N-methylidenebutanamide (PubChem CID 154988275) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is (2S)-2-[[4-(aminomethyl)phenyl]carbamoylamino]-4-ethylsulfanyl-N-methylidenebutanamide.
| Compound Name | (2S)-2-[[4-(aminomethyl)phenyl]carbamoylamino]-4-ethylsulfanyl-N-methylidenebutanamide |
|---|---|
| PubChem CID | 154988275 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (2S)-2-[[4-(aminomethyl)phenyl]carbamoylamino]-4-ethylsulfanyl-N-methylidenebutanamide |
| SMILES | C=NC(=O)[C@H](CCSCC)NC(=O)Nc1ccc(CN)cc1 |
| InChI | InChI=1S/C15H22N4O2S/c1-3-22-9-8-13(14(20)17-2)19-15(21)18-12-6-4-11(10-16)5-7-12/h4-7,13H,2-3,8-10,16H2,1H3,(H2,18,19,21)/t13-/m0/s1 |
| InChIKey | JBFLMCGOPVEUJT-ZDUSSCGKSA-N |
| XLogP | 2.01 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|