C29H23FN2O6 — CID 16682210
CID 16682210 (PubChem CID 16682210) has the molecular formula C29H23FN2O6 and a molecular weight of 514.51 g/mol.
| Compound Name | CID 16682210 |
|---|---|
| PubChem CID | 16682210 |
| Molecular Formula | C29H23FN2O6 |
| Molecular Weight | 514.51 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | — |
| SMILES | O=C(c1ccc2c(c1)OCO2)N1CCC2(CC1)Oc1ccc(F)cc1C(=O)C21CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C29H23FN2O6/c30-20-7-9-23-21(15-20)26(33)29(16-22(31-38-29)18-4-2-1-3-5-18)28(37-23)10-12-32(13-11-28)27(34)19-6-8-24-25(14-19)36-17-35-24/h1-9,14-15H,10-13,16-17H2 |
| InChIKey | TZVFUFRCUOACND-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 86.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |