C27H23ClN2O4S — CID 16746069
CID 16746069 (PubChem CID 16746069) has the molecular formula C27H23ClN2O4S and a molecular weight of 507.01 g/mol.
| Compound Name | CID 16746069 |
|---|---|
| PubChem CID | 16746069 |
| Molecular Formula | C27H23ClN2O4S |
| Molecular Weight | 507.01 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C(=O)N2CCC3(CC2)Oc2ccc(Cl)cc2C(=O)C32CC(c3ccccc3)=NO2)s1 |
| InChI | InChI=1S/C27H23ClN2O4S/c1-17-7-10-23(35-17)25(32)30-13-11-26(12-14-30)27(16-21(29-34-27)18-5-3-2-4-6-18)24(31)20-15-19(28)8-9-22(20)33-26/h2-10,15H,11-14,16H2,1H3 |
| InChIKey | VTENRXBGHKPPIW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.01 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |