About CID 16746069
CID 16746069 (PubChem CID 16746069) has the molecular formula C27H23ClN2O4S
and a molecular weight of 507.01 g/mol.
Molecular Properties
| Compound Name | CID 16746069 |
| PubChem CID | 16746069 |
| Molecular Formula | C27H23ClN2O4S |
| Molecular Weight | 507.01 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C(=O)N2CCC3(CC2)Oc2ccc(Cl)cc2C(=O)C32CC(c3ccccc3)=NO2)s1 |
| InChI | InChI=1S/C27H23ClN2O4S/c1-17-7-10-23(35-17)25(32)30-13-11-26(12-14-30)27(16-21(29-34-27)18-5-3-2-4-6-18)24(31)20-15-19(28)8-9-22(20)33-26/h2-10,15H,11-14,16H2,1H3 |
| InChIKey | VTENRXBGHKPPIW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.01 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 16746069 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 16746069?
The IUPAC name of CID 16746069 (CID 16746069) is not available.
What is the SMILES notation for CID 16746069?
The canonical SMILES for CID 16746069 is Cc1ccc(C(=O)N2CCC3(CC2)Oc2ccc(Cl)cc2C(=O)C32CC(c3ccccc3)=NO2)s1.
What is the InChIKey of CID 16746069?
The InChIKey is VTENRXBGHKPPIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23ClN2O4S/c1-17-7-10-23(35-17)25(32)30-13-11-26(12-14-30)27(16-21(29-34-27)18-5-3-2-4-6-18)24(31)20-15-19(28)8-9-22(20)33-26/h2-10,15H,11-14,16H2,1H3.
What are the key properties of CID 16746069?
CID 16746069 has a molecular weight of 507.01 g/mol, XLogP of 5.52, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 16746069 is sourced from PubChem (CID 16746069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).