C13H27N2P — CID 166822142
4-[[di(propan-2-yl)amino]-propylphosphanyl]butanenitrile (PubChem CID 166822142) has the molecular formula C13H27N2P and a molecular weight of 242.35 g/mol. Its IUPAC name is 4-[[di(propan-2-yl)amino]-propylphosphanyl]butanenitrile.
| Compound Name | 4-[[di(propan-2-yl)amino]-propylphosphanyl]butanenitrile |
|---|---|
| PubChem CID | 166822142 |
| Molecular Formula | C13H27N2P |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 4-[[di(propan-2-yl)amino]-propylphosphanyl]butanenitrile |
| SMILES | CCCP(CCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C13H27N2P/c1-6-10-16(11-8-7-9-14)15(12(2)3)13(4)5/h12-13H,6-8,10-11H2,1-5H3 |
| InChIKey | LRHHCPJSFNQVFU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|