C17H24ClN3OS — CID 16682433
(2-methyl-6-propoxy-3-propylquinolin-4-yl) carbamimidothioate;hydrochloride (PubChem CID 16682433) has the molecular formula C17H24ClN3OS and a molecular weight of 353.92 g/mol. Its IUPAC name is (2-methyl-6-propoxy-3-propylquinolin-4-yl) carbamimidothioate;hydrochloride.
| Compound Name | (2-methyl-6-propoxy-3-propylquinolin-4-yl) carbamimidothioate;hydrochloride |
|---|---|
| PubChem CID | 16682433 |
| Molecular Formula | C17H24ClN3OS |
| Molecular Weight | 353.92 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (2-methyl-6-propoxy-3-propylquinolin-4-yl) carbamimidothioate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)Sc1c(CCC)c(C)nc2ccc(OCCC)cc12 |
| InChI | InChI=1S/C17H23N3OS.ClH/c1-4-6-13-11(3)20-15-8-7-12(21-9-5-2)10-14(15)16(13)22-17(18)19;/h7-8,10H,4-6,9H2,1-3H3,(H3,18,19);1H |
| InChIKey | MTXAVNNDHZEKBD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.92 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|