C16H18N2O7S — CID 16682450
benzenesulfonic acid;(4-nitrophenyl)methyl (2S)-2-aminopropanoate (PubChem CID 16682450) has the molecular formula C16H18N2O7S and a molecular weight of 382.39 g/mol. Its IUPAC name is benzenesulfonic acid;(4-nitrophenyl)methyl (2S)-2-aminopropanoate.
| Compound Name | benzenesulfonic acid;(4-nitrophenyl)methyl (2S)-2-aminopropanoate |
|---|---|
| PubChem CID | 16682450 |
| Molecular Formula | C16H18N2O7S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | benzenesulfonic acid;(4-nitrophenyl)methyl (2S)-2-aminopropanoate |
| SMILES | C[C@H](N)C(=O)OCc1ccc([N+](=O)[O-])cc1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C10H12N2O4.C6H6O3S/c1-7(11)10(13)16-6-8-2-4-9(5-3-8)12(14)15;7-10(8,9)6-4-2-1-3-5-6/h2-5,7H,6,11H2,1H3;1-5H,(H,7,8,9)/t7-;/m0./s1 |
| InChIKey | GVMSFDXOJRBTQR-FJXQXJEOSA-N |
| XLogP | 1.92 |
| TPSA | 149.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|