C22H28N2O6S — CID 139224241
[(2R)-2-[(4-methylphenyl)sulfonylamino]octyl] 4-nitrobenzoate (PubChem CID 139224241) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is [(2R)-2-[(4-methylphenyl)sulfonylamino]octyl] 4-nitrobenzoate.
| Compound Name | [(2R)-2-[(4-methylphenyl)sulfonylamino]octyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 139224241 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | [(2R)-2-[(4-methylphenyl)sulfonylamino]octyl] 4-nitrobenzoate |
| SMILES | CCCCCC[C@H](COC(=O)c1ccc([N+](=O)[O-])cc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H28N2O6S/c1-3-4-5-6-7-19(23-31(28,29)21-14-8-17(2)9-15-21)16-30-22(25)18-10-12-20(13-11-18)24(26)27/h8-15,19,23H,3-7,16H2,1-2H3/t19-/m1/s1 |
| InChIKey | IFSKYWDXGZKQCL-LJQANCHMSA-N |
| XLogP | 4.38 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|