C19H28N2S — CID 16682577
(5S)-1-(4-cyclohexylbutyl)-5-phenylimidazolidine-2-thione (PubChem CID 16682577) has the molecular formula C19H28N2S and a molecular weight of 316.51 g/mol. Its IUPAC name is (5S)-1-(4-cyclohexylbutyl)-5-phenylimidazolidine-2-thione.
| Compound Name | (5S)-1-(4-cyclohexylbutyl)-5-phenylimidazolidine-2-thione |
|---|---|
| PubChem CID | 16682577 |
| Molecular Formula | C19H28N2S |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (5S)-1-(4-cyclohexylbutyl)-5-phenylimidazolidine-2-thione |
| SMILES | S=C1NC[C@H](c2ccccc2)N1CCCCC1CCCCC1 |
| InChI | InChI=1S/C19H28N2S/c22-19-20-15-18(17-12-5-2-6-13-17)21(19)14-8-7-11-16-9-3-1-4-10-16/h2,5-6,12-13,16,18H,1,3-4,7-11,14-15H2,(H,20,22)/t18-/m1/s1 |
| InChIKey | GUOBUCYMINOGNV-GOSISDBHSA-N |
| XLogP | 4.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|