C14H22FP — CID 166829962
(4,5-ditert-butyl-2-fluorophenyl)phosphane (PubChem CID 166829962) has the molecular formula C14H22FP and a molecular weight of 240.30 g/mol. Its IUPAC name is (4,5-ditert-butyl-2-fluorophenyl)phosphane.
| Compound Name | (4,5-ditert-butyl-2-fluorophenyl)phosphane |
|---|---|
| PubChem CID | 166829962 |
| Molecular Formula | C14H22FP |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (4,5-ditert-butyl-2-fluorophenyl)phosphane |
| SMILES | CC(C)(C)c1cc(F)c(P)cc1C(C)(C)C |
| InChI | InChI=1S/C14H22FP/c1-13(2,3)9-7-11(15)12(16)8-10(9)14(4,5)6/h7-8H,16H2,1-6H3 |
| InChIKey | FDNMIUQPEFZVHP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|