C11H14N2 — CID 166830053
(1E,3Z)-2-(3-methyl-2-pyridinyl)penta-1,3-dien-1-amine (PubChem CID 166830053) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is (1E,3Z)-2-(3-methyl-2-pyridinyl)penta-1,3-dien-1-amine.
| Compound Name | (1E,3Z)-2-(3-methyl-2-pyridinyl)penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 166830053 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (1E,3Z)-2-(3-methyl-2-pyridinyl)penta-1,3-dien-1-amine |
| SMILES | C/C=C\C(=C/N)c1ncccc1C |
| InChI | InChI=1S/C11H14N2/c1-3-5-10(8-12)11-9(2)6-4-7-13-11/h3-8H,12H2,1-2H3/b5-3-,10-8+ |
| InChIKey | WBTLFGRXLCTSGN-WEZLDLNLSA-N |
| XLogP | 2.27 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|