C43H47NP2 — CID 166830176
(1R)-1-[(2S)-3-cyclopentyl-2-diphenylphosphanylcyclopentyl]-1-(2-diphenylphosphanylphenyl)-N,N-dimethylmethanamine (PubChem CID 166830176) has the molecular formula C43H47NP2 and a molecular weight of 639.80 g/mol. Its IUPAC name is (1R)-1-[(2S)-3-cyclopentyl-2-diphenylphosphanylcyclopentyl]-1-(2-diphenylphosphanylphenyl)-N,N-dimethylmethanamine.
| Compound Name | (1R)-1-[(2S)-3-cyclopentyl-2-diphenylphosphanylcyclopentyl]-1-(2-diphenylphosphanylphenyl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 166830176 |
| Molecular Formula | C43H47NP2 |
| Molecular Weight | 639.80 g/mol |
| Exact Mass | 639.32 |
| IUPAC Name | (1R)-1-[(2S)-3-cyclopentyl-2-diphenylphosphanylcyclopentyl]-1-(2-diphenylphosphanylphenyl)-N,N-dimethylmethanamine |
| SMILES | CN(C)[C@@H](c1ccccc1P(c1ccccc1)c1ccccc1)C1CCC(C2CCCC2)[C@@H]1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H47NP2/c1-44(2)42(39-29-17-18-30-41(39)45(34-21-7-3-8-22-34)35-23-9-4-10-24-35)40-32-31-38(33-19-15-16-20-33)43(40)46(36-25-11-5-12-26-36)37-27-13-6-14-28-37/h3-14,17-18,21-30,33,38,40,42-43H,15-16,19-20,31-32H2,1-2H3/t38?,40?,42-,43-/m0/s1 |
| InChIKey | NOKBYTWYHLWLOA-GJZPZAAZSA-N |
| XLogP | 8.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.80 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|