C43H49FeNP2 — CID 131730615
cyclopentane;(1S)-1-(2-diphenylphosphanylcyclopentyl)-1-(3-diphenylphosphanylphenyl)-N,N-dimethylmethanamine;iron (PubChem CID 131730615) has the molecular formula C43H49FeNP2 and a molecular weight of 697.66 g/mol. Its IUPAC name is cyclopentane;(1S)-1-(2-diphenylphosphanylcyclopentyl)-1-(3-diphenylphosphanylphenyl)-N,N-dimethylmethanamine;iron.
| Compound Name | cyclopentane;(1S)-1-(2-diphenylphosphanylcyclopentyl)-1-(3-diphenylphosphanylphenyl)-N,N-dimethylmethanamine;iron |
|---|---|
| PubChem CID | 131730615 |
| Molecular Formula | C43H49FeNP2 |
| Molecular Weight | 697.66 g/mol |
| Exact Mass | 697.27 |
| IUPAC Name | cyclopentane;(1S)-1-(2-diphenylphosphanylcyclopentyl)-1-(3-diphenylphosphanylphenyl)-N,N-dimethylmethanamine;iron |
| SMILES | C1CCCC1.CN(C)[C@H](c1cccc(P(c2ccccc2)c2ccccc2)c1)C1CCCC1P(c1ccccc1)c1ccccc1.[Fe] |
| InChI | InChI=1S/C38H39NP2.C5H10.Fe/c1-39(2)38(36-27-16-28-37(36)41(33-22-11-5-12-23-33)34-24-13-6-14-25-34)30-17-15-26-35(29-30)40(31-18-7-3-8-19-31)32-20-9-4-10-21-32;1-2-4-5-3-1;/h3-15,17-26,29,36-38H,16,27-28H2,1-2H3;1-5H2;/t36?,37?,38-;;/m1../s1 |
| InChIKey | ZFKFIACYNZOSDG-JBAAILRCSA-N |
| XLogP | 9.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.66 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|