C27H53N3O5 — CID 166830240
N-(5,6-dihydroxyhexyl)-N-(2-hydroxyethyl)-8-(6-piperidin-1-ylhexanoylamino)octanamide (PubChem CID 166830240) has the molecular formula C27H53N3O5 and a molecular weight of 499.74 g/mol. Its IUPAC name is N-(5,6-dihydroxyhexyl)-N-(2-hydroxyethyl)-8-(6-piperidin-1-ylhexanoylamino)octanamide.
| Compound Name | N-(5,6-dihydroxyhexyl)-N-(2-hydroxyethyl)-8-(6-piperidin-1-ylhexanoylamino)octanamide |
|---|---|
| PubChem CID | 166830240 |
| Molecular Formula | C27H53N3O5 |
| Molecular Weight | 499.74 g/mol |
| Exact Mass | 499.40 |
| IUPAC Name | N-(5,6-dihydroxyhexyl)-N-(2-hydroxyethyl)-8-(6-piperidin-1-ylhexanoylamino)octanamide |
| SMILES | O=C(CCCCCN1CCCCC1)NCCCCCCCC(=O)N(CCO)CCCCC(O)CO |
| InChI | InChI=1S/C27H53N3O5/c31-23-22-30(21-13-8-14-25(33)24-32)27(35)16-7-2-1-3-9-17-28-26(34)15-6-4-10-18-29-19-11-5-12-20-29/h25,31-33H,1-24H2,(H,28,34) |
| InChIKey | WFIQSPFXBVSQPF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.74 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|