C26H51N3O4 — CID 166830249
N-(5,6-dihydroxyhexyl)-8-[(4-methyl-6-piperidin-1-ylhexanoyl)amino]octanamide (PubChem CID 166830249) has the molecular formula C26H51N3O4 and a molecular weight of 469.71 g/mol. Its IUPAC name is N-(5,6-dihydroxyhexyl)-8-[(4-methyl-6-piperidin-1-ylhexanoyl)amino]octanamide.
| Compound Name | N-(5,6-dihydroxyhexyl)-8-[(4-methyl-6-piperidin-1-ylhexanoyl)amino]octanamide |
|---|---|
| PubChem CID | 166830249 |
| Molecular Formula | C26H51N3O4 |
| Molecular Weight | 469.71 g/mol |
| Exact Mass | 469.39 |
| IUPAC Name | N-(5,6-dihydroxyhexyl)-8-[(4-methyl-6-piperidin-1-ylhexanoyl)amino]octanamide |
| SMILES | CC(CCC(=O)NCCCCCCCC(=O)NCCCCC(O)CO)CCN1CCCCC1 |
| InChI | InChI=1S/C26H51N3O4/c1-23(16-21-29-19-10-5-11-20-29)14-15-26(33)28-17-8-4-2-3-6-13-25(32)27-18-9-7-12-24(31)22-30/h23-24,30-31H,2-22H2,1H3,(H,27,32)(H,28,33) |
| InChIKey | XKWUJWZOWPMFGH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.71 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|