C24H47N3O5 — CID 166830221
N-(5,6-dihydroxyhexyl)-8-[3-(2-piperidin-1-ylethoxy)propanoylamino]octanamide (PubChem CID 166830221) has the molecular formula C24H47N3O5 and a molecular weight of 457.66 g/mol. Its IUPAC name is N-(5,6-dihydroxyhexyl)-8-[3-(2-piperidin-1-ylethoxy)propanoylamino]octanamide.
| Compound Name | N-(5,6-dihydroxyhexyl)-8-[3-(2-piperidin-1-ylethoxy)propanoylamino]octanamide |
|---|---|
| PubChem CID | 166830221 |
| Molecular Formula | C24H47N3O5 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.35 |
| IUPAC Name | N-(5,6-dihydroxyhexyl)-8-[3-(2-piperidin-1-ylethoxy)propanoylamino]octanamide |
| SMILES | O=C(CCCCCCCNC(=O)CCOCCN1CCCCC1)NCCCCC(O)CO |
| InChI | InChI=1S/C24H47N3O5/c28-21-22(29)11-6-8-15-25-23(30)12-5-2-1-3-7-14-26-24(31)13-19-32-20-18-27-16-9-4-10-17-27/h22,28-29H,1-21H2,(H,25,30)(H,26,31) |
| InChIKey | OZUSBMUHAWNDEQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|