C17H20ClN5O4 — CID 166834509
1-(5-chloro-2-formyl-4-methoxyphenyl)-3-[4-(3-hydroxypropylamino)-6-methylpyrimidin-2-yl]urea (PubChem CID 166834509) has the molecular formula C17H20ClN5O4 and a molecular weight of 393.83 g/mol. Its IUPAC name is 1-(5-chloro-2-formyl-4-methoxyphenyl)-3-[4-(3-hydroxypropylamino)-6-methylpyrimidin-2-yl]urea.
| Compound Name | 1-(5-chloro-2-formyl-4-methoxyphenyl)-3-[4-(3-hydroxypropylamino)-6-methylpyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 166834509 |
| Molecular Formula | C17H20ClN5O4 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1-(5-chloro-2-formyl-4-methoxyphenyl)-3-[4-(3-hydroxypropylamino)-6-methylpyrimidin-2-yl]urea |
| SMILES | COc1cc(C=O)c(NC(=O)Nc2nc(C)cc(NCCCO)n2)cc1Cl |
| InChI | InChI=1S/C17H20ClN5O4/c1-10-6-15(19-4-3-5-24)22-16(20-10)23-17(26)21-13-8-12(18)14(27-2)7-11(13)9-25/h6-9,24H,3-5H2,1-2H3,(H3,19,20,21,22,23,26) |
| InChIKey | XWNKFHWSZLOZBX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|