C16H20N2O2 — CID 166834682
4-(4-methoxy-2-methylquinolin-6-yl)-1,4-oxazepane (PubChem CID 166834682) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-(4-methoxy-2-methylquinolin-6-yl)-1,4-oxazepane.
| Compound Name | 4-(4-methoxy-2-methylquinolin-6-yl)-1,4-oxazepane |
|---|---|
| PubChem CID | 166834682 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-(4-methoxy-2-methylquinolin-6-yl)-1,4-oxazepane |
| SMILES | COc1cc(C)nc2ccc(N3CCCOCC3)cc12 |
| InChI | InChI=1S/C16H20N2O2/c1-12-10-16(19-2)14-11-13(4-5-15(14)17-12)18-6-3-8-20-9-7-18/h4-5,10-11H,3,6-9H2,1-2H3 |
| InChIKey | UOOBGZMLYVNTHW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |