C29H33N5O6 — CID 166835518
4-formyl-9-[[4-(hydroxycarbamoyl)phenyl]methyl]-6-methoxy-N-methyl-N-[3-(prop-2-enoylamino)propyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxamide (PubChem CID 166835518) has the molecular formula C29H33N5O6 and a molecular weight of 547.61 g/mol. Its IUPAC name is 4-formyl-9-[[4-(hydroxycarbamoyl)phenyl]methyl]-6-methoxy-N-methyl-N-[3-(prop-2-enoylamino)propyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxamide.
| Compound Name | 4-formyl-9-[[4-(hydroxycarbamoyl)phenyl]methyl]-6-methoxy-N-methyl-N-[3-(prop-2-enoylamino)propyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 166835518 |
| Molecular Formula | C29H33N5O6 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 4-formyl-9-[[4-(hydroxycarbamoyl)phenyl]methyl]-6-methoxy-N-methyl-N-[3-(prop-2-enoylamino)propyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxamide |
| SMILES | C=CC(=O)NCCCN(C)C(=O)N1Cc2c(c3cc(OC)ccc3n2Cc2ccc(C(=O)NO)cc2)C(C=O)C1 |
| InChI | InChI=1S/C29H33N5O6/c1-4-26(36)30-12-5-13-32(2)29(38)33-16-21(18-35)27-23-14-22(40-3)10-11-24(23)34(25(27)17-33)15-19-6-8-20(9-7-19)28(37)31-39/h4,6-11,14,18,21,39H,1,5,12-13,15-17H2,2-3H3,(H,30,36)(H,31,37) |
| InChIKey | OPOMUWQIAAFAGC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 133.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|