C8H10FN — CID 166836669
6-fluoro-3,7-dimethyl-4H-azepine (PubChem CID 166836669) has the molecular formula C8H10FN and a molecular weight of 139.17 g/mol. Its IUPAC name is 6-fluoro-3,7-dimethyl-4H-azepine.
| Compound Name | 6-fluoro-3,7-dimethyl-4H-azepine |
|---|---|
| PubChem CID | 166836669 |
| Molecular Formula | C8H10FN |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | 6-fluoro-3,7-dimethyl-4H-azepine |
| SMILES | CC1=CN=C(C)C(F)=CC1 |
| InChI | InChI=1S/C8H10FN/c1-6-3-4-8(9)7(2)10-5-6/h4-5H,3H2,1-2H3 |
| InChIKey | ZPTWUFWIXSFWMV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |