About tritert-butylalumane
tritert-butylalumane (PubChem CID 16683952) has the molecular formula C12H27Al
and a molecular weight of 198.33 g/mol. Its IUPAC name is tritert-butylalumane.
Molecular Properties
| Compound Name | tritert-butylalumane |
| PubChem CID | 16683952 |
| Molecular Formula | C12H27Al |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.19 |
| IUPAC Name | tritert-butylalumane |
| SMILES | CC(C)(C)[Al](C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/3C4H9.Al/c3*1-4(2)3;/h3*1-3H3; |
| InChIKey | RTAKQLTYPVIOBZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tritert-butylalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tritert-butylalumane?
The IUPAC name of tritert-butylalumane (CID 16683952) is tritert-butylalumane.
What is the SMILES notation for tritert-butylalumane?
The canonical SMILES for tritert-butylalumane is CC(C)(C)[Al](C(C)(C)C)C(C)(C)C.
What is the InChIKey of tritert-butylalumane?
The InChIKey is RTAKQLTYPVIOBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/3C4H9.Al/c3*1-4(2)3;/h3*1-3H3;.
What are the key properties of tritert-butylalumane?
tritert-butylalumane has a molecular weight of 198.33 g/mol, XLogP of 4.88, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tritert-butylalumane is sourced from PubChem (CID 16683952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).