About tert-butylaluminum(2+) difluoride
tert-butylaluminum(2+) difluoride (PubChem CID 87203786) has the molecular formula C4H9AlF2
and a molecular weight of 122.09 g/mol. Its IUPAC name is tert-butylaluminum(2+) difluoride.
Molecular Properties
| Compound Name | tert-butylaluminum(2+) difluoride |
| PubChem CID | 87203786 |
| Molecular Formula | C4H9AlF2 |
| Molecular Weight | 122.09 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | tert-butylaluminum(2+) difluoride |
| SMILES | CC(C)(C)[Al+2].[F-].[F-] |
| InChI | InChI=1S/C4H9.Al.2FH/c1-4(2)3;;;/h1-3H3;;2*1H/q;+2;;/p-2 |
| InChIKey | SZVYAYSZFSWUTK-UHFFFAOYSA-L |
| XLogP | -4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.09 |
| LogP ≤ 5 | -4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tert-butylaluminum(2+) difluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylaluminum(2+) difluoride?
The IUPAC name of tert-butylaluminum(2+) difluoride (CID 87203786) is tert-butylaluminum(2+) difluoride.
What is the SMILES notation for tert-butylaluminum(2+) difluoride?
The canonical SMILES for tert-butylaluminum(2+) difluoride is CC(C)(C)[Al+2].[F-].[F-].
What is the InChIKey of tert-butylaluminum(2+) difluoride?
The InChIKey is SZVYAYSZFSWUTK-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H9.Al.2FH/c1-4(2)3;;;/h1-3H3;;2*1H/q;+2;;/p-2.
What are the key properties of tert-butylaluminum(2+) difluoride?
tert-butylaluminum(2+) difluoride has a molecular weight of 122.09 g/mol, XLogP of -4.62, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylaluminum(2+) difluoride is sourced from PubChem (CID 87203786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).