About tritert-butylphosphanium;trifluoroborane;fluoride
tritert-butylphosphanium;trifluoroborane;fluoride (PubChem CID 91654223) has the molecular formula C12H28BF4P
and a molecular weight of 290.13 g/mol. Its IUPAC name is tritert-butylphosphanium;trifluoroborane;fluoride.
Molecular Properties
| Compound Name | tritert-butylphosphanium;trifluoroborane;fluoride |
| PubChem CID | 91654223 |
| Molecular Formula | C12H28BF4P |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | tritert-butylphosphanium;trifluoroborane;fluoride |
| SMILES | CC(C)(C)[PH+](C(C)(C)C)C(C)(C)C.FB(F)F.[F-] |
| InChI | InChI=1S/C12H27P.BF3.FH/c1-10(2,3)13(11(4,5)6)12(7,8)9;2-1(3)4;/h1-9H3;;1H |
| InChIKey | YSTLBJVHZMEEAC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tritert-butylphosphanium;trifluoroborane;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tritert-butylphosphanium;trifluoroborane;fluoride?
The IUPAC name of tritert-butylphosphanium;trifluoroborane;fluoride (CID 91654223) is tritert-butylphosphanium;trifluoroborane;fluoride.
What is the SMILES notation for tritert-butylphosphanium;trifluoroborane;fluoride?
The canonical SMILES for tritert-butylphosphanium;trifluoroborane;fluoride is CC(C)(C)[PH+](C(C)(C)C)C(C)(C)C.FB(F)F.[F-].
What is the InChIKey of tritert-butylphosphanium;trifluoroborane;fluoride?
The InChIKey is YSTLBJVHZMEEAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27P.BF3.FH/c1-10(2,3)13(11(4,5)6)12(7,8)9;2-1(3)4;/h1-9H3;;1H.
What are the key properties of tritert-butylphosphanium;trifluoroborane;fluoride?
tritert-butylphosphanium;trifluoroborane;fluoride has a molecular weight of 290.13 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tritert-butylphosphanium;trifluoroborane;fluoride is sourced from PubChem (CID 91654223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).