C11H14F2N2O2 — CID 166839830
(2,3-difluorophenyl) N-[2-(methylamino)propan-2-yl]carbamate (PubChem CID 166839830) has the molecular formula C11H14F2N2O2 and a molecular weight of 244.24 g/mol. Its IUPAC name is (2,3-difluorophenyl) N-[2-(methylamino)propan-2-yl]carbamate.
| Compound Name | (2,3-difluorophenyl) N-[2-(methylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 166839830 |
| Molecular Formula | C11H14F2N2O2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | (2,3-difluorophenyl) N-[2-(methylamino)propan-2-yl]carbamate |
| SMILES | CNC(C)(C)NC(=O)Oc1cccc(F)c1F |
| InChI | InChI=1S/C11H14F2N2O2/c1-11(2,14-3)15-10(16)17-8-6-4-5-7(12)9(8)13/h4-6,14H,1-3H3,(H,15,16) |
| InChIKey | SOLFKVYMRBILAE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|