C25H24N6O3 — CID 166841024
N-[4-[[4-(prop-2-enoylamino)bicyclo[2.1.1]hexane-2-carbonyl]amino]phenyl]-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide (PubChem CID 166841024) has the molecular formula C25H24N6O3 and a molecular weight of 456.51 g/mol. Its IUPAC name is N-[4-[[4-(prop-2-enoylamino)bicyclo[2.1.1]hexane-2-carbonyl]amino]phenyl]-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide.
| Compound Name | N-[4-[[4-(prop-2-enoylamino)bicyclo[2.1.1]hexane-2-carbonyl]amino]phenyl]-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166841024 |
| Molecular Formula | C25H24N6O3 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | N-[4-[[4-(prop-2-enoylamino)bicyclo[2.1.1]hexane-2-carbonyl]amino]phenyl]-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide |
| SMILES | C=CC(=O)NC12CC(C1)C(C(=O)Nc1ccc(NC(=O)c3cccc(-c4ccn[nH]4)n3)cc1)C2 |
| InChI | InChI=1S/C25H24N6O3/c1-2-22(32)30-25-12-15(13-25)18(14-25)23(33)27-16-6-8-17(9-7-16)28-24(34)21-5-3-4-19(29-21)20-10-11-26-31-20/h2-11,15,18H,1,12-14H2,(H,26,31)(H,27,33)(H,28,34)(H,30,32) |
| InChIKey | HMZOEJPIPLLGLQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|