C33H34F3NO2 — CID 166841678
6-[4-(1,1-difluoroethyl)phenyl]-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carbaldehyde (PubChem CID 166841678) has the molecular formula C33H34F3NO2 and a molecular weight of 533.63 g/mol. Its IUPAC name is 6-[4-(1,1-difluoroethyl)phenyl]-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carbaldehyde.
| Compound Name | 6-[4-(1,1-difluoroethyl)phenyl]-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carbaldehyde |
|---|---|
| PubChem CID | 166841678 |
| Molecular Formula | C33H34F3NO2 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 6-[4-(1,1-difluoroethyl)phenyl]-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carbaldehyde |
| SMILES | CC(F)(F)c1ccc(C2=C(c3ccc(OC4CCN(CCCF)C4)cc3)c3ccc(C=O)cc3CCC2)cc1 |
| InChI | InChI=1S/C33H34F3NO2/c1-33(35,36)27-11-7-24(8-12-27)30-5-2-4-26-20-23(22-38)6-15-31(26)32(30)25-9-13-28(14-10-25)39-29-16-19-37(21-29)18-3-17-34/h6-15,20,22,29H,2-5,16-19,21H2,1H3 |
| InChIKey | IZPBEAPCMGCIBL-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|