About [diethyl(phenyl)stannyl] acetate
[diethyl(phenyl)stannyl] acetate (PubChem CID 16684174) has the molecular formula C12H18O2Sn
and a molecular weight of 312.99 g/mol. Its IUPAC name is [diethyl(phenyl)stannyl] acetate.
Molecular Properties
| Compound Name | [diethyl(phenyl)stannyl] acetate |
| PubChem CID | 16684174 |
| Molecular Formula | C12H18O2Sn |
| Molecular Weight | 312.99 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | [diethyl(phenyl)stannyl] acetate |
| SMILES | CC[Sn](CC)(OC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C6H5.C2H4O2.2C2H5.Sn/c1-2-4-6-5-3-1;1-2(3)4;2*1-2;/h1-5H;1H3,(H,3,4);2*1H2,2H3;/q;;;;+1/p-1 |
| InChIKey | OABMYCPSAUZSIK-UHFFFAOYSA-M |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.99 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [diethyl(phenyl)stannyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diethyl(phenyl)stannyl] acetate?
The IUPAC name of [diethyl(phenyl)stannyl] acetate (CID 16684174) is [diethyl(phenyl)stannyl] acetate.
What is the SMILES notation for [diethyl(phenyl)stannyl] acetate?
The canonical SMILES for [diethyl(phenyl)stannyl] acetate is CC[Sn](CC)(OC(C)=O)c1ccccc1.
What is the InChIKey of [diethyl(phenyl)stannyl] acetate?
The InChIKey is OABMYCPSAUZSIK-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5.C2H4O2.2C2H5.Sn/c1-2-4-6-5-3-1;1-2(3)4;2*1-2;/h1-5H;1H3,(H,3,4);2*1H2,2H3;/q;;;;+1/p-1.
What are the key properties of [diethyl(phenyl)stannyl] acetate?
[diethyl(phenyl)stannyl] acetate has a molecular weight of 312.99 g/mol, XLogP of 2.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [diethyl(phenyl)stannyl] acetate is sourced from PubChem (CID 16684174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).