About tributylstannyl pyridine-3-carboxylate
tributylstannyl pyridine-3-carboxylate (PubChem CID 16684183) has the molecular formula C18H31NO2Sn
and a molecular weight of 412.16 g/mol. Its IUPAC name is tributylstannyl pyridine-3-carboxylate.
Molecular Properties
| Compound Name | tributylstannyl pyridine-3-carboxylate |
| PubChem CID | 16684183 |
| Molecular Formula | C18H31NO2Sn |
| Molecular Weight | 412.16 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | tributylstannyl pyridine-3-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)OC(=O)c1cccnc1 |
| InChI | InChI=1S/C6H5NO2.3C4H9.Sn/c8-6(9)5-2-1-3-7-4-5;3*1-3-4-2;/h1-4H,(H,8,9);3*1,3-4H2,2H3;/q;;;;+1/p-1 |
| InChIKey | RXWDMDWQNOJWJY-UHFFFAOYSA-M |
| XLogP | 5.58 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.16 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tributylstannyl pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributylstannyl pyridine-3-carboxylate?
The IUPAC name of tributylstannyl pyridine-3-carboxylate (CID 16684183) is tributylstannyl pyridine-3-carboxylate.
What is the SMILES notation for tributylstannyl pyridine-3-carboxylate?
The canonical SMILES for tributylstannyl pyridine-3-carboxylate is CCCC[Sn](CCCC)(CCCC)OC(=O)c1cccnc1.
What is the InChIKey of tributylstannyl pyridine-3-carboxylate?
The InChIKey is RXWDMDWQNOJWJY-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5NO2.3C4H9.Sn/c8-6(9)5-2-1-3-7-4-5;3*1-3-4-2;/h1-4H,(H,8,9);3*1,3-4H2,2H3;/q;;;;+1/p-1.
What are the key properties of tributylstannyl pyridine-3-carboxylate?
tributylstannyl pyridine-3-carboxylate has a molecular weight of 412.16 g/mol, XLogP of 5.58, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tributylstannyl pyridine-3-carboxylate is sourced from PubChem (CID 16684183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).