About Nicotinate
Nicotinate (PubChem CID 937) has the molecular formula C6H4NO2-
and a molecular weight of 122.10 g/mol. Its IUPAC name is pyridine-3-carboxylate.
Molecular Properties
| Compound Name | Nicotinate |
| PubChem CID | 937 |
| Molecular Formula | C6H4NO2- |
| Molecular Weight | 122.10 g/mol |
| Exact Mass | 122.02 |
| IUPAC Name | pyridine-3-carboxylate |
| SMILES | C1=CC(=CN=C1)C(=O)[O-] |
| InChI | InChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9)/p-1 |
| InChIKey | PVNIIMVLHYAWGP-UHFFFAOYSA-M |
| XLogP | 0.90 |
| TPSA | 53.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | 108 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.10 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Nicotinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Nicotinate?
The IUPAC name of Nicotinate (CID 937) is pyridine-3-carboxylate.
What is the SMILES notation for Nicotinate?
The canonical SMILES for Nicotinate is C1=CC(=CN=C1)C(=O)[O-].
What is the InChIKey of Nicotinate?
The InChIKey is PVNIIMVLHYAWGP-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9)/p-1.
What are the key properties of Nicotinate?
Nicotinate has a molecular weight of 122.10 g/mol, XLogP of 0.90, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Nicotinate is sourced from PubChem (CID 937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).